 | | Assay: | Inhibition of recombinant His6-tagged c-Myc bHLH-ZIP domain (353 to 437 amino acid residues) (unknown origin) assessed as disruption of Myc-Max dimerization by electrophoretic mobility shift assay | | Type: | IC50 | | SMILES: | O=C(O)c1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1 | | Value: | =33000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of recombinant His6-tagged c-Myc bHLH-ZIP domain (353 to 437 amino acid residues) (unknown origin) assessed as disruption of Myc-Max dimerization by electrophoretic mobility shift assay | | Type: | IC50 | | SMILES: | O=[N+]([O-])c1ccc(Nc2ccccc2-c2ccccc2)c2nonc12 | | Value: | =146000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to human c-Myc bHLH-ZIP domain (353 to 437 amino acid residues) expressed in Escherichia coli BL21 (DE3) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=[N+]([O-])c1ccc(Nc2ccccc2-c2ccccc2)c2nonc12 | | Value: | =2800nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Myc signaling pathway in human HeLa cells assessed as inhibition of PMA induced luciferase treated 30 mins before induction | | Type: | IC50 | | SMILES: | Oc1ccc(/C=C/c2cc(O)cc(O)c2)cc1 | | Value: | =60000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of Myc signaling pathway in human HeLa cells assessed as inhibition of PMA induced luciferase treated 30 mins before induction | | Type: | IC50 | | SMILES: | COc1cc(/C=C\c2ccc(OC)c(OC)c2)cc(OC)c1 | | Value: | =60000nM | | Source: | Homo sapiens |
|
 | | Assay: | Inhibition of c-MYC in human HL60 cells by chemiluminescence assay | | Type: | IC50 | | SMILES: | CC(C)c1ccc(/C=C2\SC(=S)N(CN3CCCCC3)C2=O)cc1 | | Value: | =29000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=[N+]([O-])c1ccc(Nc2ccccc2-c2ccccc2)c2nonc12 | | Value: | =2800nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | CCc1ccc(/C=C2\SC(=S)NC2=O)cc1 | | Value: | =5700nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=[N+]([O-])c1ccc(Nc2ccccc2)c2nonc12 | | Value: | =7000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | CN(C)c1ccc([N+](=O)[O-])c2nonc12 | | Value: | >200000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=C(O)c1ccccc1Nc1ccc([N+](=O)[O-])c2nonc12 | | Value: | =13000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=C(O)c1cccc(Nc2ccc([N+](=O)[O-])c3nonc23)c1 | | Value: | =16000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=C(O)c1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1 | | Value: | =3000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | CC(=O)NCCCCCOC(=O)c1ccc(Nc2ccc([N+](=O)[O-])c3nonc23)cc1 | | Value: | =1700nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=C1NC(=S)S/C1=C\c1ccc(C(=O)O)cc1 | | Value: | =26000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | CC(=O)NCCCCCNC(=O)c1ccc(/C=C2\SC(=S)NC2=O)cc1 | | Value: | =90000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | CCc1ccc(/C=C2\SC(=O)N(CCCCCCNC(C)=O)C2=O)cc1 | | Value: | =7000nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=C1NC(=S)S/C1=C\c1ccc(C(=O)NCCCCCNC(=O)c2ccccc2Nc2ccc([N+](=O)[O-])c3nonc23)cc1 | | Value: | =24nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | O=C1NC(=S)S/C1=C/c1ccc(C(=O)NCCCCCNC(=O)c2ccc(Nc3ccc([N+](=O)[O-])c4nonc34)cc2)cc1 | | Value: | =4.7nM | | Source: | Homo sapiens |
|
 | | Assay: | Binding affinity to recombinant full-length N-terminal hexahistidine-tagged c-Myc (353 to 437 residues) bHLH-ZIP domain (unknown origin) expressed in Escherichia coli BL21 DE3 (pLysS) by fluorescence polarization assay | | Type: | Kd | | SMILES: | CCc1ccc(/C=C2\SC(=O)N(CCCCCNC(=O)c3ccccc3Nc3ccc([N+](=O)[O-])c4nonc34)C2=O)cc1 | | Value: | =2.2nM | | Source: | Homo sapiens |
|
